C12H21O3PS2 — CID 10638548
2-diethoxyphosphoryl-3-prop-2-enyl-6,7-dihydro-5H-1,4-dithiepine (PubChem CID 10638548) has the molecular formula C12H21O3PS2 and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-3-prop-2-enyl-6,7-dihydro-5H-1,4-dithiepine.
| Compound Name | 2-diethoxyphosphoryl-3-prop-2-enyl-6,7-dihydro-5H-1,4-dithiepine |
|---|---|
| PubChem CID | 10638548 |
| Molecular Formula | C12H21O3PS2 |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 2-diethoxyphosphoryl-3-prop-2-enyl-6,7-dihydro-5H-1,4-dithiepine |
| SMILES | C=CCC1=C(P(=O)(OCC)OCC)SCCCS1 |
| InChI | InChI=1S/C12H21O3PS2/c1-4-8-11-12(18-10-7-9-17-11)16(13,14-5-2)15-6-3/h4H,1,5-10H2,2-3H3 |
| InChIKey | BHLUIXJZPHTBPP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|