C19H37NO6P2 — CID 123953131
cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropan-1-amine;cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenyl-1-methylcyclopropane (PubChem CID 123953131) has the molecular formula C19H37NO6P2 and a molecular weight of 437.45 g/mol. Its IUPAC name is cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropan-1-amine;cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenyl-1-methylcyclopropane.
| Compound Name | cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropan-1-amine;cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenyl-1-methylcyclopropane |
|---|---|
| PubChem CID | 123953131 |
| Molecular Formula | C19H37NO6P2 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenylcyclopropan-1-amine;cis-(1S,2S)-1-diethoxyphosphoryl-2-ethenyl-1-methylcyclopropane |
| SMILES | C=C[C@@H]1C[C@]1(C)P(=O)(OCC)OCC.C=C[C@@H]1C[C@]1(N)P(=O)(OCC)OCC |
| InChI | InChI=1S/C10H19O3P.C9H18NO3P/c1-5-9-8-10(9,4)14(11,12-6-2)13-7-3;1-4-8-7-9(8,10)14(11,12-5-2)13-6-3/h5,9H,1,6-8H2,2-4H3;4,8H,1,5-7,10H2,2-3H3/t9-,10+;8-,9+/m11/s1 |
| InChIKey | BWZJWBWCYJUMBQ-QIQQXUAKSA-N |
| XLogP | 5.33 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|