C15H30O6P2 — CID 102483175
1,1-bis(diethoxyphosphoryl)-3-methyl-4-methylidenecyclopentane (PubChem CID 102483175) has the molecular formula C15H30O6P2 and a molecular weight of 368.35 g/mol. Its IUPAC name is 1,1-bis(diethoxyphosphoryl)-3-methyl-4-methylidenecyclopentane.
| Compound Name | 1,1-bis(diethoxyphosphoryl)-3-methyl-4-methylidenecyclopentane |
|---|---|
| PubChem CID | 102483175 |
| Molecular Formula | C15H30O6P2 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1,1-bis(diethoxyphosphoryl)-3-methyl-4-methylidenecyclopentane |
| SMILES | C=C1CC(P(=O)(OCC)OCC)(P(=O)(OCC)OCC)CC1C |
| InChI | InChI=1S/C15H30O6P2/c1-7-18-22(16,19-8-2)15(11-13(5)14(6)12-15)23(17,20-9-3)21-10-4/h14H,5,7-12H2,1-4,6H3 |
| InChIKey | IGMNRBPHKBQQGR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|