C8H15O3P — CID 58212588
[(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxyphosphinic acid (PubChem CID 58212588) has the molecular formula C8H15O3P and a molecular weight of 190.18 g/mol. Its IUPAC name is [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxyphosphinic acid.
| Compound Name | [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxyphosphinic acid |
|---|---|
| PubChem CID | 58212588 |
| Molecular Formula | C8H15O3P |
| Molecular Weight | 190.18 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | [(1S,2S)-2-ethenyl-1-methylcyclopropyl]-ethoxyphosphinic acid |
| SMILES | C=C[C@@H]1C[C@]1(C)P(=O)(O)OCC |
| InChI | InChI=1S/C8H15O3P/c1-4-7-6-8(7,3)12(9,10)11-5-2/h4,7H,1,5-6H2,2-3H3,(H,9,10)/t7-,8+/m1/s1 |
| InChIKey | ZACFLUUATNNYGT-SFYZADRCSA-N |
| XLogP | 2.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|