C8H12ClNO2 — CID 87414825
cis-ethyl (1R,2R)-1-(chloroamino)-2-ethenylcyclopropane-1-carboxylate (PubChem CID 87414825) has the molecular formula C8H12ClNO2 and a molecular weight of 189.64 g/mol. Its IUPAC name is cis-ethyl (1R,2R)-1-(chloroamino)-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1R,2R)-1-(chloroamino)-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 87414825 |
| Molecular Formula | C8H12ClNO2 |
| Molecular Weight | 189.64 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | cis-ethyl (1R,2R)-1-(chloroamino)-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@]1(NCl)C(=O)OCC |
| InChI | InChI=1S/C8H12ClNO2/c1-3-6-5-8(6,10-9)7(11)12-4-2/h3,6,10H,1,4-5H2,2H3/t6-,8+/m0/s1 |
| InChIKey | JITIMOFUKXRMBP-POYBYMJQSA-N |
| XLogP | 1.24 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.64 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|