C11H17O8P — CID 59027122
1-O-ethyl 1-O'-(2-phosphonooxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate (PubChem CID 59027122) has the molecular formula C11H17O8P and a molecular weight of 308.22 g/mol. Its IUPAC name is 1-O-ethyl 1-O'-(2-phosphonooxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate.
| Compound Name | 1-O-ethyl 1-O'-(2-phosphonooxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 59027122 |
| Molecular Formula | C11H17O8P |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1-O-ethyl 1-O'-(2-phosphonooxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate |
| SMILES | C=CC1CC1(C(=O)OCC)C(=O)OCCOP(=O)(O)O |
| InChI | InChI=1S/C11H17O8P/c1-3-8-7-11(8,9(12)17-4-2)10(13)18-5-6-19-20(14,15)16/h3,8H,1,4-7H2,2H3,(H2,14,15,16) |
| InChIKey | XQOVJZSEUBZJDT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|