C19H32O8 — CID 57266237
bis[2-(2-ethoxyethoxy)ethyl] 2-ethenylcyclopropane-1,1-dicarboxylate (PubChem CID 57266237) has the molecular formula C19H32O8 and a molecular weight of 388.46 g/mol. Its IUPAC name is bis[2-(2-ethoxyethoxy)ethyl] 2-ethenylcyclopropane-1,1-dicarboxylate.
| Compound Name | bis[2-(2-ethoxyethoxy)ethyl] 2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 57266237 |
| Molecular Formula | C19H32O8 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | bis[2-(2-ethoxyethoxy)ethyl] 2-ethenylcyclopropane-1,1-dicarboxylate |
| SMILES | C=CC1CC1(C(=O)OCCOCCOCC)C(=O)OCCOCCOCC |
| InChI | InChI=1S/C19H32O8/c1-4-16-15-19(16,17(20)26-13-11-24-9-7-22-5-2)18(21)27-14-12-25-10-8-23-6-3/h4,16H,1,5-15H2,2-3H3 |
| InChIKey | JXQLIDJEVIQWFG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|