C34H50N2O12 — CID 134240411
1-O'-[2-[[5-[2-(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)oxyethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]ethyl] 1-O-ethyl 2-ethenylcyclopropane-1,1-dicarboxylate (PubChem CID 134240411) has the molecular formula C34H50N2O12 and a molecular weight of 678.78 g/mol. Its IUPAC name is 1-O'-[2-[[5-[2-(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)oxyethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]ethyl] 1-O-ethyl 2-ethenylcyclopropane-1,1-dicarboxylate.
| Compound Name | 1-O'-[2-[[5-[2-(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)oxyethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]ethyl] 1-O-ethyl 2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134240411 |
| Molecular Formula | C34H50N2O12 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.34 |
| IUPAC Name | 1-O'-[2-[[5-[2-(2-ethenyl-1-ethoxycarbonylcyclopropanecarbonyl)oxyethoxycarbonylamino]-1,3,3-trimethylcyclohexyl]methylcarbamoyloxy]ethyl] 1-O-ethyl 2-ethenylcyclopropane-1,1-dicarboxylate |
| SMILES | C=CC1CC1(C(=O)OCC)C(=O)OCCOC(=O)NCC1(C)CC(NC(=O)OCCOC(=O)C2(C(=O)OCC)CC2C=C)CC(C)(C)C1 |
| InChI | InChI=1S/C34H50N2O12/c1-8-22-16-33(22,25(37)43-10-3)27(39)45-12-14-47-29(41)35-21-32(7)19-24(18-31(5,6)20-32)36-30(42)48-15-13-46-28(40)34(17-23(34)9-2)26(38)44-11-4/h8-9,22-24H,1-2,10-21H2,3-7H3,(H,35,41)(H,36,42) |
| InChIKey | XADWRTXDSYKXTE-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|