C22H34O11 — CID 159587669
ethane-1,2-diol;2-ethenyl-1-ethoxycarbonylcyclopropane-1-carboxylic acid;1-O-ethyl 1-O'-(2-hydroxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate (PubChem CID 159587669) has the molecular formula C22H34O11 and a molecular weight of 474.50 g/mol. Its IUPAC name is ethane-1,2-diol;2-ethenyl-1-ethoxycarbonylcyclopropane-1-carboxylic acid;1-O-ethyl 1-O'-(2-hydroxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate.
| Compound Name | ethane-1,2-diol;2-ethenyl-1-ethoxycarbonylcyclopropane-1-carboxylic acid;1-O-ethyl 1-O'-(2-hydroxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 159587669 |
| Molecular Formula | C22H34O11 |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | ethane-1,2-diol;2-ethenyl-1-ethoxycarbonylcyclopropane-1-carboxylic acid;1-O-ethyl 1-O'-(2-hydroxyethyl) 2-ethenylcyclopropane-1,1-dicarboxylate |
| SMILES | C=CC1CC1(C(=O)O)C(=O)OCC.C=CC1CC1(C(=O)OCC)C(=O)OCCO.OCCO |
| InChI | InChI=1S/C11H16O5.C9H12O4.C2H6O2/c1-3-8-7-11(8,9(13)15-4-2)10(14)16-6-5-12;1-3-6-5-9(6,7(10)11)8(12)13-4-2;3-1-2-4/h3,8,12H,1,4-7H2,2H3;3,6H,1,4-5H2,2H3,(H,10,11);3-4H,1-2H2 |
| InChIKey | MJVHEMXLVBITBO-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|