C9H11F3O3 — CID 10585207
ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate (PubChem CID 10585207) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate.
| Compound Name | ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate |
|---|---|
| PubChem CID | 10585207 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate |
| SMILES | C=CC1COC(F)(F)C1(F)C(=O)OCC |
| InChI | InChI=1S/C9H11F3O3/c1-3-6-5-15-9(11,12)8(6,10)7(13)14-4-2/h3,6H,1,4-5H2,2H3 |
| InChIKey | CKSPSSBJNMMMJT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|