About ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate
ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate (PubChem CID 10585207) has the molecular formula C9H11F3O3
and a molecular weight of 224.18 g/mol. Its IUPAC name is ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate |
| PubChem CID | 10585207 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate |
| SMILES | C=CC1COC(F)(F)C1(F)C(=O)OCC |
| InChI | InChI=1S/C9H11F3O3/c1-3-6-5-15-9(11,12)8(6,10)7(13)14-4-2/h3,6H,1,4-5H2,2H3 |
| InChIKey | CKSPSSBJNMMMJT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate?
The IUPAC name of ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate (CID 10585207) is ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate.
What is the SMILES notation for ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate?
The canonical SMILES for ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate is C=CC1COC(F)(F)C1(F)C(=O)OCC.
What is the InChIKey of ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate?
The InChIKey is CKSPSSBJNMMMJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3O3/c1-3-6-5-15-9(11,12)8(6,10)7(13)14-4-2/h3,6H,1,4-5H2,2H3.
What are the key properties of ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate?
ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate has a molecular weight of 224.18 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-ethenyl-2,2,3-trifluorooxolane-3-carboxylate is sourced from PubChem (CID 10585207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).