C11H14F2N2O2 — CID 102002532
ethyl (3aS,5S,6aR)-5-ethenyl-6,6-difluoro-1,3a,4,5-tetrahydrocyclopenta[c]pyrazole-6a-carboxylate (PubChem CID 102002532) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is ethyl (3aS,5S,6aR)-5-ethenyl-6,6-difluoro-1,3a,4,5-tetrahydrocyclopenta[c]pyrazole-6a-carboxylate.
| Compound Name | ethyl (3aS,5S,6aR)-5-ethenyl-6,6-difluoro-1,3a,4,5-tetrahydrocyclopenta[c]pyrazole-6a-carboxylate |
|---|---|
| PubChem CID | 102002532 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | ethyl (3aS,5S,6aR)-5-ethenyl-6,6-difluoro-1,3a,4,5-tetrahydrocyclopenta[c]pyrazole-6a-carboxylate |
| SMILES | C=C[C@@H]1C[C@@H]2C=NN[C@]2(C(=O)OCC)C1(F)F |
| InChI | InChI=1S/C11H14F2N2O2/c1-3-7-5-8-6-14-15-10(8,11(7,12)13)9(16)17-4-2/h3,6-8,15H,1,4-5H2,2H3/t7-,8-,10-/m1/s1 |
| InChIKey | AIMCQEAEIVNUSZ-NQMVMOMDSA-N |
| XLogP | 1.33 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|