C10H13F3O3 — CID 118202106
ethyl 2,2,3-trifluoro-3-methyl-1-prop-2-enoxycyclopropane-1-carboxylate (PubChem CID 118202106) has the molecular formula C10H13F3O3 and a molecular weight of 238.20 g/mol. Its IUPAC name is ethyl 2,2,3-trifluoro-3-methyl-1-prop-2-enoxycyclopropane-1-carboxylate.
| Compound Name | ethyl 2,2,3-trifluoro-3-methyl-1-prop-2-enoxycyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118202106 |
| Molecular Formula | C10H13F3O3 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | ethyl 2,2,3-trifluoro-3-methyl-1-prop-2-enoxycyclopropane-1-carboxylate |
| SMILES | C=CCOC1(C(=O)OCC)C(C)(F)C1(F)F |
| InChI | InChI=1S/C10H13F3O3/c1-4-6-16-9(7(14)15-5-2)8(3,11)10(9,12)13/h4H,1,5-6H2,2-3H3 |
| InChIKey | KERHMLMWLUDFLS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|