C16H24O4 — CID 11630536
diethyl (2R)-2-ethenyl-3-propan-2-ylidenecyclopentane-1,1-dicarboxylate (PubChem CID 11630536) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is diethyl (2R)-2-ethenyl-3-propan-2-ylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (2R)-2-ethenyl-3-propan-2-ylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11630536 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | diethyl (2R)-2-ethenyl-3-propan-2-ylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C[C@@H]1C(=C(C)C)CCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H24O4/c1-6-13-12(11(4)5)9-10-16(13,14(17)19-7-2)15(18)20-8-3/h6,13H,1,7-10H2,2-5H3/t13-/m1/s1 |
| InChIKey | MEXFJVIMCGUBAM-CYBMUJFWSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|