C15H23NO6 — CID 135019100
diethyl 2-ethoxy-5-oxo-1-prop-2-enylpyrrolidine-3,3-dicarboxylate (PubChem CID 135019100) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is diethyl 2-ethoxy-5-oxo-1-prop-2-enylpyrrolidine-3,3-dicarboxylate.
| Compound Name | diethyl 2-ethoxy-5-oxo-1-prop-2-enylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135019100 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | diethyl 2-ethoxy-5-oxo-1-prop-2-enylpyrrolidine-3,3-dicarboxylate |
| SMILES | C=CCN1C(=O)CC(C(=O)OCC)(C(=O)OCC)C1OCC |
| InChI | InChI=1S/C15H23NO6/c1-5-9-16-11(17)10-15(12(16)20-6-2,13(18)21-7-3)14(19)22-8-4/h5,12H,1,6-10H2,2-4H3 |
| InChIKey | PWPPPTMOSPGKBD-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|