C14H19NO5 — CID 135040675
dimethyl 5-oxo-1,2-bis(prop-2-enyl)pyrrolidine-3,3-dicarboxylate (PubChem CID 135040675) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is dimethyl 5-oxo-1,2-bis(prop-2-enyl)pyrrolidine-3,3-dicarboxylate.
| Compound Name | dimethyl 5-oxo-1,2-bis(prop-2-enyl)pyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 135040675 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | dimethyl 5-oxo-1,2-bis(prop-2-enyl)pyrrolidine-3,3-dicarboxylate |
| SMILES | C=CCC1N(CC=C)C(=O)CC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H19NO5/c1-5-7-10-14(12(17)19-3,13(18)20-4)9-11(16)15(10)8-6-2/h5-6,10H,1-2,7-9H2,3-4H3 |
| InChIKey | OTOUDNATNBIPFT-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|