C21H28N2O9 — CID 12966700
trimethyl (2S,3S,4S,5R)-5-[(2S,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]-2-methyl-1-prop-2-enoylpyrrolidine-2,3,4-tricarboxylate (PubChem CID 12966700) has the molecular formula C21H28N2O9 and a molecular weight of 452.46 g/mol. Its IUPAC name is trimethyl (2S,3S,4S,5R)-5-[(2S,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]-2-methyl-1-prop-2-enoylpyrrolidine-2,3,4-tricarboxylate.
| Compound Name | trimethyl (2S,3S,4S,5R)-5-[(2S,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]-2-methyl-1-prop-2-enoylpyrrolidine-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 12966700 |
| Molecular Formula | C21H28N2O9 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | trimethyl (2S,3S,4S,5R)-5-[(2S,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]-2-methyl-1-prop-2-enoylpyrrolidine-2,3,4-tricarboxylate |
| SMILES | C=CCN1C(=O)[C@H](OC)[C@@H]1[C@H]1[C@@H](C(=O)OC)[C@H](C(=O)OC)[C@@](C)(C(=O)OC)N1C(=O)C=C |
| InChI | InChI=1S/C21H28N2O9/c1-8-10-22-15(16(29-4)17(22)25)14-12(18(26)30-5)13(19(27)31-6)21(3,20(28)32-7)23(14)11(24)9-2/h8-9,12-16H,1-2,10H2,3-7H3/t12-,13+,14+,15-,16+,21-/m0/s1 |
| InChIKey | RSHDKRNEHMWKGC-TZEQEEPBSA-N |
| XLogP | -0.69 |
| TPSA | 128.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|