C19H23NO3 — CID 10903091
methyl (2S,4R,5S)-4-benzyl-1-prop-2-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 10903091) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl (2S,4R,5S)-4-benzyl-1-prop-2-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R,5S)-4-benzyl-1-prop-2-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10903091 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl (2S,4R,5S)-4-benzyl-1-prop-2-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CC[C@H]1[C@H](Cc2ccccc2)C[C@@H](C(=O)OC)N1C(=O)C=C |
| InChI | InChI=1S/C19H23NO3/c1-4-9-16-15(12-14-10-7-6-8-11-14)13-17(19(22)23-3)20(16)18(21)5-2/h4-8,10-11,15-17H,1-2,9,12-13H2,3H3/t15-,16+,17+/m1/s1 |
| InChIKey | OYVCPHDPHHZZAQ-IKGGRYGDSA-N |
| XLogP | 2.75 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|