C16H19NO2S — CID 11140801
methyl (2S,4R)-1-benzyl-4-prop-2-enyl-5-sulfanylidenepyrrolidine-2-carboxylate (PubChem CID 11140801) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is methyl (2S,4R)-1-benzyl-4-prop-2-enyl-5-sulfanylidenepyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-benzyl-4-prop-2-enyl-5-sulfanylidenepyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11140801 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | methyl (2S,4R)-1-benzyl-4-prop-2-enyl-5-sulfanylidenepyrrolidine-2-carboxylate |
| SMILES | C=CC[C@@H]1C[C@@H](C(=O)OC)N(Cc2ccccc2)C1=S |
| InChI | InChI=1S/C16H19NO2S/c1-3-7-13-10-14(16(18)19-2)17(15(13)20)11-12-8-5-4-6-9-12/h3-6,8-9,13-14H,1,7,10-11H2,2H3/t13-,14+/m1/s1 |
| InChIKey | ZESNAWYURNMXKK-KGLIPLIRSA-N |
| XLogP | 2.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|