C20H25NO3 — CID 11077935
methyl (2S,4R,5S)-4-benzyl-1-but-3-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate (PubChem CID 11077935) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl (2S,4R,5S)-4-benzyl-1-but-3-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R,5S)-4-benzyl-1-but-3-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 11077935 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl (2S,4R,5S)-4-benzyl-1-but-3-enoyl-5-prop-2-enylpyrrolidine-2-carboxylate |
| SMILES | C=CCC(=O)N1[C@H](C(=O)OC)C[C@@H](Cc2ccccc2)[C@@H]1CC=C |
| InChI | InChI=1S/C20H25NO3/c1-4-9-17-16(13-15-11-7-6-8-12-15)14-18(20(23)24-3)21(17)19(22)10-5-2/h4-8,11-12,16-18H,1-2,9-10,13-14H2,3H3/t16-,17+,18+/m1/s1 |
| InChIKey | VZGLMTJHRHAULC-SQNIBIBYSA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|