C23H33NO4 — CID 11143566
1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-(3-phenylpropyl)-5-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 11143566) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-(3-phenylpropyl)-5-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-(3-phenylpropyl)-5-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11143566 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 1-O-tert-butyl 2-O-methyl (2S,4R,5S)-4-(3-phenylpropyl)-5-[(Z)-prop-1-enyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | C/C=C\[C@@H]1[C@H](CCCc2ccccc2)C[C@@H](C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33NO4/c1-6-11-19-18(15-10-14-17-12-8-7-9-13-17)16-20(21(25)27-5)24(19)22(26)28-23(2,3)4/h6-9,11-13,18-20H,10,14-16H2,1-5H3/b11-6-/t18-,19-,20+/m1/s1 |
| InChIKey | LPSHJXVZQKIAQK-HPUYKBIGSA-N |
| XLogP | 4.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|