C16H21NO4 — CID 11130068
methyl (3S,5S)-2-benzyl-5-(prop-2-enoxymethyl)-1,2-oxazolidine-3-carboxylate (PubChem CID 11130068) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is methyl (3S,5S)-2-benzyl-5-(prop-2-enoxymethyl)-1,2-oxazolidine-3-carboxylate.
| Compound Name | methyl (3S,5S)-2-benzyl-5-(prop-2-enoxymethyl)-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 11130068 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | methyl (3S,5S)-2-benzyl-5-(prop-2-enoxymethyl)-1,2-oxazolidine-3-carboxylate |
| SMILES | C=CCOC[C@@H]1C[C@@H](C(=O)OC)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C16H21NO4/c1-3-9-20-12-14-10-15(16(18)19-2)17(21-14)11-13-7-5-4-6-8-13/h3-8,14-15H,1,9-12H2,2H3/t14-,15-/m0/s1 |
| InChIKey | FPSZHHNFOAYKRC-GJZGRUSLSA-N |
| XLogP | 1.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|