C24H39N3O7Si — CID 11504416
methyl (1R,3S)-1-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]methyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 11504416) has the molecular formula C24H39N3O7Si and a molecular weight of 509.68 g/mol. Its IUPAC name is methyl (1R,3S)-1-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]methyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S)-1-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]methyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 11504416 |
| Molecular Formula | C24H39N3O7Si |
| Molecular Weight | 509.68 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | methyl (1R,3S)-1-[(R)-[tert-butyl(dimethyl)silyl]oxy-[(2R,3R)-3-methoxy-4-oxo-1-prop-2-enylazetidin-2-yl]methyl]-3,5-dimethyl-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | C=CCN1C(=O)[C@H](OC)[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1N[C@](C)(C(=O)OC)C2C(=O)N(C)C(=O)C21 |
| InChI | InChI=1S/C24H39N3O7Si/c1-11-12-27-16(18(32-7)21(27)30)17(34-35(9,10)23(2,3)4)15-13-14(20(29)26(6)19(13)28)24(5,25-15)22(31)33-8/h11,13-18,25H,1,12H2,2-10H3/t13?,14?,15-,16+,17-,18-,24+/m1/s1 |
| InChIKey | GFBJRLWYCNWPFU-RWGAXDAASA-N |
| XLogP | 0.92 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.68 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|