C28H55NO4Si3 — CID 11261408
(3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-1-prop-2-enylpyrrolidin-2-one (PubChem CID 11261408) has the molecular formula C28H55NO4Si3 and a molecular weight of 554.01 g/mol. Its IUPAC name is (3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-1-prop-2-enylpyrrolidin-2-one.
| Compound Name | (3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-1-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 11261408 |
| Molecular Formula | C28H55NO4Si3 |
| Molecular Weight | 554.01 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | (3S,4R,5R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-[3-[tert-butyl(dimethyl)silyl]oxyprop-1-ynyl]-1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCN1C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1C#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H55NO4Si3/c1-17-20-29-22(19-18-21-31-34(11,12)26(2,3)4)23(32-35(13,14)27(5,6)7)24(25(29)30)33-36(15,16)28(8,9)10/h17,22-24H,1,20-21H2,2-16H3/t22-,23-,24+/m1/s1 |
| InChIKey | MEGSVCFSWDBBCX-SMIHKQSGSA-N |
| XLogP | 7.19 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.01 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|