C23H42O3Si2 — CID 11122706
4-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohex-2-en-1-one (PubChem CID 11122706) has the molecular formula C23H42O3Si2 and a molecular weight of 422.76 g/mol. Its IUPAC name is 4-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohex-2-en-1-one.
| Compound Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11122706 |
| Molecular Formula | C23H42O3Si2 |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | 4-[tert-butyl(dimethyl)silyl]oxy-2-[(2E)-1-[tert-butyl(dimethyl)silyl]oxypenta-2,4-dien-2-yl]cyclohex-2-en-1-one |
| SMILES | C=C/C=C(/CO[Si](C)(C)C(C)(C)C)C1=CC(O[Si](C)(C)C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C23H42O3Si2/c1-12-13-18(17-25-27(8,9)22(2,3)4)20-16-19(14-15-21(20)24)26-28(10,11)23(5,6)7/h12-13,16,19H,1,14-15,17H2,2-11H3/b18-13- |
| InChIKey | GPCYGLUVECMDOY-AQTBWJFISA-N |
| XLogP | 6.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|