C15H31O3PSi — CID 22281267
butyl-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]phosphinic acid (PubChem CID 22281267) has the molecular formula C15H31O3PSi and a molecular weight of 318.47 g/mol. Its IUPAC name is butyl-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]phosphinic acid.
| Compound Name | butyl-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]phosphinic acid |
|---|---|
| PubChem CID | 22281267 |
| Molecular Formula | C15H31O3PSi |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | butyl-[3-[tert-butyl(dimethyl)silyl]oxycyclopenten-1-yl]phosphinic acid |
| SMILES | CCCCP(=O)(O)C1=CC(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H31O3PSi/c1-7-8-11-19(16,17)14-10-9-13(12-14)18-20(5,6)15(2,3)4/h12-13H,7-11H2,1-6H3,(H,16,17) |
| InChIKey | DBAHLNKCEJRXCU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|