C20H39NO2Si — CID 132606609
(6R,10S,11S)-11-butyl-10-[tert-butyl(dimethyl)silyl]oxy-1-azaspiro[5.5]undecan-2-one (PubChem CID 132606609) has the molecular formula C20H39NO2Si and a molecular weight of 353.62 g/mol. Its IUPAC name is (6R,10S,11S)-11-butyl-10-[tert-butyl(dimethyl)silyl]oxy-1-azaspiro[5.5]undecan-2-one.
| Compound Name | (6R,10S,11S)-11-butyl-10-[tert-butyl(dimethyl)silyl]oxy-1-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 132606609 |
| Molecular Formula | C20H39NO2Si |
| Molecular Weight | 353.62 g/mol |
| Exact Mass | 353.28 |
| IUPAC Name | (6R,10S,11S)-11-butyl-10-[tert-butyl(dimethyl)silyl]oxy-1-azaspiro[5.5]undecan-2-one |
| SMILES | CCCC[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]12CCCC(=O)N2 |
| InChI | InChI=1S/C20H39NO2Si/c1-7-8-11-16-17(23-24(5,6)19(2,3)4)12-9-14-20(16)15-10-13-18(22)21-20/h16-17H,7-15H2,1-6H3,(H,21,22)/t16-,17+,20-/m1/s1 |
| InChIKey | GNZNDQJUAYPVNE-FUHIMQAGSA-N |
| XLogP | 5.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|