C25H51NO2SSi2 — CID 134845933
(R)-N-[(1S,2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethynyl)cyclohexyl]-2-methylpropane-2-sulfinamide (PubChem CID 134845933) has the molecular formula C25H51NO2SSi2 and a molecular weight of 485.93 g/mol. Its IUPAC name is (R)-N-[(1S,2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethynyl)cyclohexyl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(1S,2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethynyl)cyclohexyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 134845933 |
| Molecular Formula | C25H51NO2SSi2 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.32 |
| IUPAC Name | (R)-N-[(1S,2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-trimethylsilylethynyl)cyclohexyl]-2-methylpropane-2-sulfinamide |
| SMILES | CCCC[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@]1(C#C[Si](C)(C)C)N[S@](=O)C(C)(C)C |
| InChI | InChI=1S/C25H51NO2SSi2/c1-13-14-16-21-22(28-31(11,12)24(5,6)7)17-15-18-25(21,19-20-30(8,9)10)26-29(27)23(2,3)4/h21-22,26H,13-18H2,1-12H3/t21-,22+,25+,29+/m0/s1 |
| InChIKey | VZWQEXHWEIZBTE-HKNWWBGHSA-N |
| XLogP | 7.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|