C16H33NO2Si — CID 25178808
(NE)-N-[(2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxycyclohexylidene]hydroxylamine (PubChem CID 25178808) has the molecular formula C16H33NO2Si and a molecular weight of 299.53 g/mol. Its IUPAC name is (NE)-N-[(2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxycyclohexylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxycyclohexylidene]hydroxylamine |
|---|---|
| PubChem CID | 25178808 |
| Molecular Formula | C16H33NO2Si |
| Molecular Weight | 299.53 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | (NE)-N-[(2R,3R)-2-butyl-3-[tert-butyl(dimethyl)silyl]oxycyclohexylidene]hydroxylamine |
| SMILES | CCCC[C@@H]1/C(=N/O)CCC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO2Si/c1-7-8-10-13-14(17-18)11-9-12-15(13)19-20(5,6)16(2,3)4/h13,15,18H,7-12H2,1-6H3/b17-14+/t13-,15-/m1/s1 |
| InChIKey | ZWXYHWRWJKNLRG-PYJPSCCVSA-N |
| XLogP | 5.20 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|