C18H37NO2Si2 — CID 11068243
(NE)-N-[(2S,3Z)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(trimethylsilylmethylidene)cyclopentylidene]hydroxylamine (PubChem CID 11068243) has the molecular formula C18H37NO2Si2 and a molecular weight of 355.67 g/mol. Its IUPAC name is (NE)-N-[(2S,3Z)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(trimethylsilylmethylidene)cyclopentylidene]hydroxylamine.
| Compound Name | (NE)-N-[(2S,3Z)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(trimethylsilylmethylidene)cyclopentylidene]hydroxylamine |
|---|---|
| PubChem CID | 11068243 |
| Molecular Formula | C18H37NO2Si2 |
| Molecular Weight | 355.67 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (NE)-N-[(2S,3Z)-2-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-3-(trimethylsilylmethylidene)cyclopentylidene]hydroxylamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@H]1/C(=C\[Si](C)(C)C)CC/C1=N\O |
| InChI | InChI=1S/C18H37NO2Si2/c1-18(2,3)23(7,8)21-13-9-10-16-15(14-22(4,5)6)11-12-17(16)19-20/h14,16,20H,9-13H2,1-8H3/b15-14-,19-17+/t16-/m0/s1 |
| InChIKey | BWTIXFSMDLZDKM-CRMITRNKSA-N |
| XLogP | 5.83 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.67 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|