C21H42O4Si2 — CID 101414676
(1S,2R,3R,6E)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-6-(trimethylsilylmethylidene)cyclohexane-1,2,3-triol (PubChem CID 101414676) has the molecular formula C21H42O4Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is (1S,2R,3R,6E)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-6-(trimethylsilylmethylidene)cyclohexane-1,2,3-triol.
| Compound Name | (1S,2R,3R,6E)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-6-(trimethylsilylmethylidene)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 101414676 |
| Molecular Formula | C21H42O4Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | (1S,2R,3R,6E)-1-[(E)-5-[tert-butyl(dimethyl)silyl]oxypent-2-en-2-yl]-6-(trimethylsilylmethylidene)cyclohexane-1,2,3-triol |
| SMILES | C/C(=C\CCO[Si](C)(C)C(C)(C)C)[C@]1(O)/C(=C/[Si](C)(C)C)CC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H42O4Si2/c1-16(11-10-14-25-27(8,9)20(2,3)4)21(24)17(15-26(5,6)7)12-13-18(22)19(21)23/h11,15,18-19,22-24H,10,12-14H2,1-9H3/b16-11+,17-15+/t18-,19-,21+/m1/s1 |
| InChIKey | AQGGSPFHBPJBPT-DOADYZEYSA-N |
| XLogP | 4.40 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|