C15H30O2Si — CID 10061716
(2E,5E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,5-dien-1-ol (PubChem CID 10061716) has the molecular formula C15H30O2Si and a molecular weight of 270.49 g/mol. Its IUPAC name is (2E,5E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,5-dien-1-ol.
| Compound Name | (2E,5E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,5-dien-1-ol |
|---|---|
| PubChem CID | 10061716 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (2E,5E)-8-[tert-butyl(dimethyl)silyl]oxy-2-methylocta-2,5-dien-1-ol |
| SMILES | C/C(=C\C/C=C/CCO[Si](C)(C)C(C)(C)C)CO |
| InChI | InChI=1S/C15H30O2Si/c1-14(13-16)11-9-7-8-10-12-17-18(5,6)15(2,3)4/h7-8,11,16H,9-10,12-13H2,1-6H3/b8-7+,14-11+ |
| InChIKey | XMHFSTLQQJSTMP-DQBULIGTSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|