C16H36OSi2 — CID 11702169
tert-butyl-[(Z)-4-[tert-butyl(dimethyl)silyl]but-3-enoxy]-dimethylsilane (PubChem CID 11702169) has the molecular formula C16H36OSi2 and a molecular weight of 300.64 g/mol. Its IUPAC name is tert-butyl-[(Z)-4-[tert-butyl(dimethyl)silyl]but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-4-[tert-butyl(dimethyl)silyl]but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11702169 |
| Molecular Formula | C16H36OSi2 |
| Molecular Weight | 300.64 g/mol |
| Exact Mass | 300.23 |
| IUPAC Name | tert-butyl-[(Z)-4-[tert-butyl(dimethyl)silyl]but-3-enoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)/C=C\CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36OSi2/c1-15(2,3)18(7,8)14-12-11-13-17-19(9,10)16(4,5)6/h12,14H,11,13H2,1-10H3/b14-12- |
| InChIKey | FIYCXIJKJFQPKP-OWBHPGMISA-N |
| XLogP | 6.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|