C15H26N2OSi — CID 153429891
tert-butyl-dimethyl-[(E)-4-(5-methylpyrimidin-2-yl)but-3-enoxy]silane (PubChem CID 153429891) has the molecular formula C15H26N2OSi and a molecular weight of 278.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E)-4-(5-methylpyrimidin-2-yl)but-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(E)-4-(5-methylpyrimidin-2-yl)but-3-enoxy]silane |
|---|---|
| PubChem CID | 153429891 |
| Molecular Formula | C15H26N2OSi |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | tert-butyl-dimethyl-[(E)-4-(5-methylpyrimidin-2-yl)but-3-enoxy]silane |
| SMILES | Cc1cnc(/C=C/CCO[Si](C)(C)C(C)(C)C)nc1 |
| InChI | InChI=1S/C15H26N2OSi/c1-13-11-16-14(17-12-13)9-7-8-10-18-19(5,6)15(2,3)4/h7,9,11-12H,8,10H2,1-6H3/b9-7+ |
| InChIKey | NAOALPOCEUUOJX-VQHVLOKHSA-N |
| XLogP | 4.21 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|