C23H30O3Si — CID 140708617
2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-5-phenylbenzoic acid (PubChem CID 140708617) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-5-phenylbenzoic acid.
| Compound Name | 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-5-phenylbenzoic acid |
|---|---|
| PubChem CID | 140708617 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 2-[(E)-4-[tert-butyl(dimethyl)silyl]oxybut-1-enyl]-5-phenylbenzoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC/C=C/c1ccc(-c2ccccc2)cc1C(=O)O |
| InChI | InChI=1S/C23H30O3Si/c1-23(2,3)27(4,5)26-16-10-9-13-19-14-15-20(17-21(19)22(24)25)18-11-7-6-8-12-18/h6-9,11-15,17H,10,16H2,1-5H3,(H,24,25)/b13-9+ |
| InChIKey | GTISXMFXAXVLTF-UKTHLTGXSA-N |
| XLogP | 6.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|