C21H30OSi — CID 163281797
tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-(4-phenylphenyl)propoxy]silane (PubChem CID 163281797) has the molecular formula C21H30OSi and a molecular weight of 330.58 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-(4-phenylphenyl)propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-(4-phenylphenyl)propoxy]silane |
|---|---|
| PubChem CID | 163281797 |
| Molecular Formula | C21H30OSi |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl-dimethyl-[2,2,3,3-tetradeuterio-3-(4-phenylphenyl)propoxy]silane |
| SMILES | [2H]C([2H])(CO[Si](C)(C)C(C)(C)C)C([2H])([2H])c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H30OSi/c1-21(2,3)23(4,5)22-17-9-10-18-13-15-20(16-14-18)19-11-7-6-8-12-19/h6-8,11-16H,9-10,17H2,1-5H3/i9D2,10D2 |
| InChIKey | IUKHTLHROOFKNO-YQUBHJMPSA-N |
| XLogP | 6.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|