C15H25N3O3Si — CID 131746748
tert-butyl-dimethyl-[(Z)-4-(5-methylpyrimidin-2-yl)-3-nitrobut-3-enoxy]silane (PubChem CID 131746748) has the molecular formula C15H25N3O3Si and a molecular weight of 323.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(Z)-4-(5-methylpyrimidin-2-yl)-3-nitrobut-3-enoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(Z)-4-(5-methylpyrimidin-2-yl)-3-nitrobut-3-enoxy]silane |
|---|---|
| PubChem CID | 131746748 |
| Molecular Formula | C15H25N3O3Si |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | tert-butyl-dimethyl-[(Z)-4-(5-methylpyrimidin-2-yl)-3-nitrobut-3-enoxy]silane |
| SMILES | Cc1cnc(/C=C(/CCO[Si](C)(C)C(C)(C)C)[N+](=O)[O-])nc1 |
| InChI | InChI=1S/C15H25N3O3Si/c1-12-10-16-14(17-11-12)9-13(18(19)20)7-8-21-22(5,6)15(2,3)4/h9-11H,7-8H2,1-6H3/b13-9- |
| InChIKey | WGWGZFNATLSMQH-LCYFTJDESA-N |
| XLogP | 3.81 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|