C19H32O2SSi — CID 101158709
tert-butyl-dimethyl-[(3Z)-3-[(4-methylphenyl)sulfinylmethylidene]pentoxy]silane (PubChem CID 101158709) has the molecular formula C19H32O2SSi and a molecular weight of 352.62 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3Z)-3-[(4-methylphenyl)sulfinylmethylidene]pentoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3Z)-3-[(4-methylphenyl)sulfinylmethylidene]pentoxy]silane |
|---|---|
| PubChem CID | 101158709 |
| Molecular Formula | C19H32O2SSi |
| Molecular Weight | 352.62 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | tert-butyl-dimethyl-[(3Z)-3-[(4-methylphenyl)sulfinylmethylidene]pentoxy]silane |
| SMILES | CC/C(=C/S(=O)c1ccc(C)cc1)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H32O2SSi/c1-8-17(13-14-21-23(6,7)19(3,4)5)15-22(20)18-11-9-16(2)10-12-18/h9-12,15H,8,13-14H2,1-7H3/b17-15- |
| InChIKey | FUYSIBYOUCPFQK-ICFOKQHNSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.62 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|