C18H30O2SSi — CID 53306489
triethyl-[(Z)-3-methyl-4-[(R)-(4-methylphenyl)sulfinyl]but-3-en-2-yl]oxysilane (PubChem CID 53306489) has the molecular formula C18H30O2SSi and a molecular weight of 338.59 g/mol. Its IUPAC name is triethyl-[(Z)-3-methyl-4-[(R)-(4-methylphenyl)sulfinyl]but-3-en-2-yl]oxysilane.
| Compound Name | triethyl-[(Z)-3-methyl-4-[(R)-(4-methylphenyl)sulfinyl]but-3-en-2-yl]oxysilane |
|---|---|
| PubChem CID | 53306489 |
| Molecular Formula | C18H30O2SSi |
| Molecular Weight | 338.59 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | triethyl-[(Z)-3-methyl-4-[(R)-(4-methylphenyl)sulfinyl]but-3-en-2-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)OC(C)/C(C)=C\[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H30O2SSi/c1-7-22(8-2,9-3)20-17(6)16(5)14-21(19)18-12-10-15(4)11-13-18/h10-14,17H,7-9H2,1-6H3/b16-14-/t17?,21-/m1/s1 |
| InChIKey | WVMAZCCVMHLJHL-CFJJTBRWSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|