C10H10ClF2NOS — CID 165344931
3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfinylprop-1-en-2-amine (PubChem CID 165344931) has the molecular formula C10H10ClF2NOS and a molecular weight of 265.71 g/mol. Its IUPAC name is 3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfinylprop-1-en-2-amine.
| Compound Name | 3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfinylprop-1-en-2-amine |
|---|---|
| PubChem CID | 165344931 |
| Molecular Formula | C10H10ClF2NOS |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfinylprop-1-en-2-amine |
| SMILES | Cc1ccc(S(=O)C=C(N)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C10H10ClF2NOS/c1-7-2-4-8(5-3-7)16(15)6-9(14)10(11,12)13/h2-6H,14H2,1H3 |
| InChIKey | HHURWEOEDNBFNX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|