C13H13ClF2O2S — CID 23236148
1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfinylhex-5-en-2-one (PubChem CID 23236148) has the molecular formula C13H13ClF2O2S and a molecular weight of 306.76 g/mol. Its IUPAC name is 1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfinylhex-5-en-2-one.
| Compound Name | 1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfinylhex-5-en-2-one |
|---|---|
| PubChem CID | 23236148 |
| Molecular Formula | C13H13ClF2O2S |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 1-chloro-1,1-difluoro-3-(4-methylphenyl)sulfinylhex-5-en-2-one |
| SMILES | C=CCC(C(=O)C(F)(F)Cl)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H13ClF2O2S/c1-3-4-11(12(17)13(14,15)16)19(18)10-7-5-9(2)6-8-10/h3,5-8,11H,1,4H2,2H3 |
| InChIKey | RVEFBRORDURQJM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|