About (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one
(3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one (PubChem CID 101168681) has the molecular formula C14H15F3O2S
and a molecular weight of 304.33 g/mol. Its IUPAC name is (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one.
Molecular Properties
| Compound Name | (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one |
| PubChem CID | 101168681 |
| Molecular Formula | C14H15F3O2S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one |
| SMILES | C=CCC[C@H](C(=O)C(F)(F)F)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H15F3O2S/c1-3-4-5-12(13(18)14(15,16)17)20(19)11-8-6-10(2)7-9-11/h3,6-9,12H,1,4-5H2,2H3/t12-,20?/m1/s1 |
| InChIKey | MOKSFCLNPJWFDL-ZRIYNBNISA-N |
| XLogP | 3.57 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one?
The IUPAC name of (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one (CID 101168681) is (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one.
What is the SMILES notation for (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one?
The canonical SMILES for (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one is C=CCC[C@H](C(=O)C(F)(F)F)S(=O)c1ccc(C)cc1.
What is the InChIKey of (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one?
The InChIKey is MOKSFCLNPJWFDL-ZRIYNBNISA-N. The full InChI is InChI=1S/C14H15F3O2S/c1-3-4-5-12(13(18)14(15,16)17)20(19)11-8-6-10(2)7-9-11/h3,6-9,12H,1,4-5H2,2H3/t12-,20?/m1/s1.
What are the key properties of (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one?
(3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one has a molecular weight of 304.33 g/mol, XLogP of 3.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,1,1-trifluoro-3-(4-methylphenyl)sulfinylhept-6-en-2-one is sourced from PubChem (CID 101168681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).