C14H15ClF2O2S — CID 102439587
(2S)-2-[chloro(difluoro)methyl]-2-[(1R)-1-(4-methylphenyl)sulfinylbut-3-enyl]oxirane (PubChem CID 102439587) has the molecular formula C14H15ClF2O2S and a molecular weight of 320.79 g/mol. Its IUPAC name is (2S)-2-[chloro(difluoro)methyl]-2-[(1R)-1-(4-methylphenyl)sulfinylbut-3-enyl]oxirane.
| Compound Name | (2S)-2-[chloro(difluoro)methyl]-2-[(1R)-1-(4-methylphenyl)sulfinylbut-3-enyl]oxirane |
|---|---|
| PubChem CID | 102439587 |
| Molecular Formula | C14H15ClF2O2S |
| Molecular Weight | 320.79 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | (2S)-2-[chloro(difluoro)methyl]-2-[(1R)-1-(4-methylphenyl)sulfinylbut-3-enyl]oxirane |
| SMILES | C=CC[C@@H](S(=O)c1ccc(C)cc1)[C@]1(C(F)(F)Cl)CO1 |
| InChI | InChI=1S/C14H15ClF2O2S/c1-3-4-12(13(9-19-13)14(15,16)17)20(18)11-7-5-10(2)6-8-11/h3,5-8,12H,1,4,9H2,2H3/t12-,13+,20?/m1/s1 |
| InChIKey | QCCUHPNFXZQKTG-OBIPXCIUSA-N |
| XLogP | 3.65 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.79 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|