C17H15ClF2O2S — CID 10832141
1-[(R)-[(Z)-3-chloro-3,3-difluoro-2-phenylmethoxyprop-1-enyl]sulfinyl]-4-methylbenzene (PubChem CID 10832141) has the molecular formula C17H15ClF2O2S and a molecular weight of 356.82 g/mol. Its IUPAC name is 1-[(R)-[(Z)-3-chloro-3,3-difluoro-2-phenylmethoxyprop-1-enyl]sulfinyl]-4-methylbenzene.
| Compound Name | 1-[(R)-[(Z)-3-chloro-3,3-difluoro-2-phenylmethoxyprop-1-enyl]sulfinyl]-4-methylbenzene |
|---|---|
| PubChem CID | 10832141 |
| Molecular Formula | C17H15ClF2O2S |
| Molecular Weight | 356.82 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 1-[(R)-[(Z)-3-chloro-3,3-difluoro-2-phenylmethoxyprop-1-enyl]sulfinyl]-4-methylbenzene |
| SMILES | Cc1ccc([S@](=O)/C=C(\OCc2ccccc2)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C17H15ClF2O2S/c1-13-7-9-15(10-8-13)23(21)12-16(17(18,19)20)22-11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3/b16-12-/t23-/m1/s1 |
| InChIKey | IQZDLJPIONUJHP-UKQURCRRSA-N |
| XLogP | 4.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.82 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|