C20H15ClF5NO4S — CID 177424387
[(1R,2Z)-3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfanyl-2-phenylmethoxycarbonyliminopropyl] 2,2,2-trifluoroacetate (PubChem CID 177424387) has the molecular formula C20H15ClF5NO4S and a molecular weight of 495.85 g/mol. Its IUPAC name is [(1R,2Z)-3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfanyl-2-phenylmethoxycarbonyliminopropyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R,2Z)-3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfanyl-2-phenylmethoxycarbonyliminopropyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 177424387 |
| Molecular Formula | C20H15ClF5NO4S |
| Molecular Weight | 495.85 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | [(1R,2Z)-3-chloro-3,3-difluoro-1-(4-methylphenyl)sulfanyl-2-phenylmethoxycarbonyliminopropyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1ccc(S[C@@H](OC(=O)C(F)(F)F)/C(=N/C(=O)OCc2ccccc2)C(F)(F)Cl)cc1 |
| InChI | InChI=1S/C20H15ClF5NO4S/c1-12-7-9-14(10-8-12)32-16(31-17(28)20(24,25)26)15(19(21,22)23)27-18(29)30-11-13-5-3-2-4-6-13/h2-10,16H,11H2,1H3/b27-15-/t16-/m1/s1 |
| InChIKey | CITWOHCUSXXCBG-YKVGDQEKSA-N |
| XLogP | 6.13 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.85 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|