C12H10BrF2NO4 — CID 15287714
methyl (2E)-3-bromo-3,3-difluoro-2-phenylmethoxycarbonyliminopropanoate (PubChem CID 15287714) has the molecular formula C12H10BrF2NO4 and a molecular weight of 350.12 g/mol. Its IUPAC name is methyl (2E)-3-bromo-3,3-difluoro-2-phenylmethoxycarbonyliminopropanoate.
| Compound Name | methyl (2E)-3-bromo-3,3-difluoro-2-phenylmethoxycarbonyliminopropanoate |
|---|---|
| PubChem CID | 15287714 |
| Molecular Formula | C12H10BrF2NO4 |
| Molecular Weight | 350.12 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | methyl (2E)-3-bromo-3,3-difluoro-2-phenylmethoxycarbonyliminopropanoate |
| SMILES | COC(=O)/C(=N\C(=O)OCc1ccccc1)C(F)(F)Br |
| InChI | InChI=1S/C12H10BrF2NO4/c1-19-10(17)9(12(13,14)15)16-11(18)20-7-8-5-3-2-4-6-8/h2-6H,7H2,1H3/b16-9+ |
| InChIKey | ZQZFAFDETOOBHJ-CXUHLZMHSA-N |
| XLogP | 2.92 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.12 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|