C17H27IO2SSi — CID 25139104
tert-butyl-[(E)-4-iodo-4-[(S)-(4-methylphenyl)sulfinyl]but-3-enoxy]-dimethylsilane (PubChem CID 25139104) has the molecular formula C17H27IO2SSi and a molecular weight of 450.46 g/mol. Its IUPAC name is tert-butyl-[(E)-4-iodo-4-[(S)-(4-methylphenyl)sulfinyl]but-3-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-iodo-4-[(S)-(4-methylphenyl)sulfinyl]but-3-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 25139104 |
| Molecular Formula | C17H27IO2SSi |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | tert-butyl-[(E)-4-iodo-4-[(S)-(4-methylphenyl)sulfinyl]but-3-enoxy]-dimethylsilane |
| SMILES | Cc1ccc([S@](=O)/C(I)=C\CCO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H27IO2SSi/c1-14-9-11-15(12-10-14)21(19)16(18)8-7-13-20-22(5,6)17(2,3)4/h8-12H,7,13H2,1-6H3/b16-8-/t21-/m0/s1 |
| InChIKey | RGXGFTAFSDDQRW-NSUHCSJYSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|