C19H30O3SSi — CID 102330504
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhex-5-en-3-one (PubChem CID 102330504) has the molecular formula C19H30O3SSi and a molecular weight of 366.60 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhex-5-en-3-one.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhex-5-en-3-one |
|---|---|
| PubChem CID | 102330504 |
| Molecular Formula | C19H30O3SSi |
| Molecular Weight | 366.60 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-(4-methylphenyl)sulfinylhex-5-en-3-one |
| SMILES | C=CCC(=O)[C@@H](CS(=O)c1ccc(C)cc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H30O3SSi/c1-8-9-17(20)18(22-24(6,7)19(3,4)5)14-23(21)16-12-10-15(2)11-13-16/h8,10-13,18H,1,9,14H2,2-7H3/t18-,23?/m1/s1 |
| InChIKey | PGQCDSHIBJDEML-FKSKYRLFSA-N |
| XLogP | 4.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|