C20H30O4SSi — CID 11703906
tert-butyl-[[(1R,2R,4S,5R)-4-ethenyl-5-[(S)-(4-methylphenyl)sulfinyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methoxy]-dimethylsilane (PubChem CID 11703906) has the molecular formula C20H30O4SSi and a molecular weight of 394.61 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,4S,5R)-4-ethenyl-5-[(S)-(4-methylphenyl)sulfinyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,2R,4S,5R)-4-ethenyl-5-[(S)-(4-methylphenyl)sulfinyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11703906 |
| Molecular Formula | C20H30O4SSi |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | tert-butyl-[[(1R,2R,4S,5R)-4-ethenyl-5-[(S)-(4-methylphenyl)sulfinyl]-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methoxy]-dimethylsilane |
| SMILES | C=C[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2O[C@@]12[S@@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H30O4SSi/c1-8-17-20(25(21)15-11-9-14(2)10-12-15)18(24-20)16(23-17)13-22-26(6,7)19(3,4)5/h8-12,16-18H,1,13H2,2-7H3/t16-,17+,18-,20-,25+/m1/s1 |
| InChIKey | YPOAQFKZJVTSKH-SDMFYXEBSA-N |
| XLogP | 4.17 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|