C24H40O3SSi — CID 101397143
[(1R)-1-[(2R,3R)-3-[(E)-but-1-enyl]-3-(4-methylphenyl)sulfinyloxiran-2-yl]pentoxy]-tert-butyl-dimethylsilane (PubChem CID 101397143) has the molecular formula C24H40O3SSi and a molecular weight of 436.73 g/mol. Its IUPAC name is [(1R)-1-[(2R,3R)-3-[(E)-but-1-enyl]-3-(4-methylphenyl)sulfinyloxiran-2-yl]pentoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-1-[(2R,3R)-3-[(E)-but-1-enyl]-3-(4-methylphenyl)sulfinyloxiran-2-yl]pentoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101397143 |
| Molecular Formula | C24H40O3SSi |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(1R)-1-[(2R,3R)-3-[(E)-but-1-enyl]-3-(4-methylphenyl)sulfinyloxiran-2-yl]pentoxy]-tert-butyl-dimethylsilane |
| SMILES | CC/C=C/[C@]1(S(=O)c2ccc(C)cc2)O[C@@H]1[C@@H](CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H40O3SSi/c1-9-11-13-21(27-29(7,8)23(4,5)6)22-24(26-22,18-12-10-2)28(25)20-16-14-19(3)15-17-20/h12,14-18,21-22H,9-11,13H2,1-8H3/b18-12+/t21-,22-,24-,28?/m1/s1 |
| InChIKey | HRHNBOWOKJCMOF-WJKZOLBFSA-N |
| XLogP | 6.74 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|