C30H54O3Si2 — CID 11511926
(2R,4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]-4-[dimethyl(phenyl)silyl]oxolane-2-carbaldehyde (PubChem CID 11511926) has the molecular formula C30H54O3Si2 and a molecular weight of 518.93 g/mol. Its IUPAC name is (2R,4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]-4-[dimethyl(phenyl)silyl]oxolane-2-carbaldehyde.
| Compound Name | (2R,4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]-4-[dimethyl(phenyl)silyl]oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 11511926 |
| Molecular Formula | C30H54O3Si2 |
| Molecular Weight | 518.93 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | (2R,4R,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyundecyl]-4-[dimethyl(phenyl)silyl]oxolane-2-carbaldehyde |
| SMILES | CCCCCCCCCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H](C=O)C[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C30H54O3Si2/c1-9-10-11-12-13-14-15-19-22-27(33-35(7,8)30(2,3)4)29-28(23-25(24-31)32-29)34(5,6)26-20-17-16-18-21-26/h16-18,20-21,24-25,27-29H,9-15,19,22-23H2,1-8H3/t25-,27-,28-,29+/m1/s1 |
| InChIKey | SIRRLHAAMKCPHW-PXTYPYQWSA-N |
| XLogP | 8.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.93 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|